C17H27N3O2 — CID 68899041
tert-butyl N-[(1R,2R)-2-(pyridin-2-ylmethylamino)cyclohexyl]carbamate (PubChem CID 68899041) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-(pyridin-2-ylmethylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-(pyridin-2-ylmethylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 68899041 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-(pyridin-2-ylmethylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1NCc1ccccn1 |
| InChI | InChI=1S/C17H27N3O2/c1-17(2,3)22-16(21)20-15-10-5-4-9-14(15)19-12-13-8-6-7-11-18-13/h6-8,11,14-15,19H,4-5,9-10,12H2,1-3H3,(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | GTFNUVGHYPVHIA-HUUCEWRRSA-N |
| XLogP | 3.01 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |