C17H25N3O3 — CID 22986749
tert-butyl N-[2-(pyridine-2-carbonylamino)cyclohexyl]carbamate (PubChem CID 22986749) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl N-[2-(pyridine-2-carbonylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[2-(pyridine-2-carbonylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 22986749 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl N-[2-(pyridine-2-carbonylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)23-16(22)20-13-9-5-4-8-12(13)19-15(21)14-10-6-7-11-18-14/h6-7,10-13H,4-5,8-9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | LANXMHXAXZOTKJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |