C24H25N2O4P — CID 102579935
N-[(1S,2S)-2-diphenoxyphosphorylcyclohexyl]pyridine-2-carboxamide (PubChem CID 102579935) has the molecular formula C24H25N2O4P and a molecular weight of 436.45 g/mol. Its IUPAC name is N-[(1S,2S)-2-diphenoxyphosphorylcyclohexyl]pyridine-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-diphenoxyphosphorylcyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 102579935 |
| Molecular Formula | C24H25N2O4P |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[(1S,2S)-2-diphenoxyphosphorylcyclohexyl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1P(=O)(Oc1ccccc1)Oc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C24H25N2O4P/c27-24(22-16-9-10-18-25-22)26-21-15-7-8-17-23(21)31(28,29-19-11-3-1-4-12-19)30-20-13-5-2-6-14-20/h1-6,9-14,16,18,21,23H,7-8,15,17H2,(H,26,27)/t21-,23-/m0/s1 |
| InChIKey | PJKYMRBWPAGHTH-GMAHTHKFSA-N |
| XLogP | 5.47 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|