C20H23N3O4 — CID 155912516
N-[(1S,2S,4S)-2-hydroxy-4-(2-phenoxyethylcarbamoyl)cyclopentyl]pyridine-2-carboxamide (PubChem CID 155912516) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-hydroxy-4-(2-phenoxyethylcarbamoyl)cyclopentyl]pyridine-2-carboxamide.
| Compound Name | N-[(1S,2S,4S)-2-hydroxy-4-(2-phenoxyethylcarbamoyl)cyclopentyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155912516 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[(1S,2S,4S)-2-hydroxy-4-(2-phenoxyethylcarbamoyl)cyclopentyl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H](C(=O)NCCOc2ccccc2)C[C@@H]1O)c1ccccn1 |
| InChI | InChI=1S/C20H23N3O4/c24-18-13-14(12-17(18)23-20(26)16-8-4-5-9-21-16)19(25)22-10-11-27-15-6-2-1-3-7-15/h1-9,14,17-18,24H,10-13H2,(H,22,25)(H,23,26)/t14-,17-,18-/m0/s1 |
| InChIKey | HISWWGAIWQFJNG-WBAXXEDZSA-N |
| XLogP | 1.15 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|