C25H26NO4P — CID 102308889
N-[(1R,2R)-2-diphenoxyphosphorylcyclohexyl]benzamide (PubChem CID 102308889) has the molecular formula C25H26NO4P and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[(1R,2R)-2-diphenoxyphosphorylcyclohexyl]benzamide.
| Compound Name | N-[(1R,2R)-2-diphenoxyphosphorylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 102308889 |
| Molecular Formula | C25H26NO4P |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[(1R,2R)-2-diphenoxyphosphorylcyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1P(=O)(Oc1ccccc1)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26NO4P/c27-25(20-12-4-1-5-13-20)26-23-18-10-11-19-24(23)31(28,29-21-14-6-2-7-15-21)30-22-16-8-3-9-17-22/h1-9,12-17,23-24H,10-11,18-19H2,(H,26,27)/t23-,24-/m1/s1 |
| InChIKey | BDPWXOKOHKDPSS-DNQXCXABSA-N |
| XLogP | 6.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|