C19H23N2O3P — CID 23994092
N-[(cyclohexylamino)-phenoxyphosphoryl]benzamide (PubChem CID 23994092) has the molecular formula C19H23N2O3P and a molecular weight of 358.38 g/mol. Its IUPAC name is N-[(cyclohexylamino)-phenoxyphosphoryl]benzamide.
| Compound Name | N-[(cyclohexylamino)-phenoxyphosphoryl]benzamide |
|---|---|
| PubChem CID | 23994092 |
| Molecular Formula | C19H23N2O3P |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[(cyclohexylamino)-phenoxyphosphoryl]benzamide |
| SMILES | O=C(NP(=O)(NC1CCCCC1)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23N2O3P/c22-19(16-10-4-1-5-11-16)21-25(23,20-17-12-6-2-7-13-17)24-18-14-8-3-9-15-18/h1,3-5,8-11,14-15,17H,2,6-7,12-13H2,(H2,20,21,22,23) |
| InChIKey | LGEAQBZVYVADLF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|