About sodium;bis(cyclohexylamino) carbonate;benzoate
sodium;bis(cyclohexylamino) carbonate;benzoate (PubChem CID 175308886) has the molecular formula C20H29N2NaO5
and a molecular weight of 400.45 g/mol. Its IUPAC name is sodium;bis(cyclohexylamino) carbonate;benzoate.
Molecular Properties
| Compound Name | sodium;bis(cyclohexylamino) carbonate;benzoate |
| PubChem CID | 175308886 |
| Molecular Formula | C20H29N2NaO5 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | sodium;bis(cyclohexylamino) carbonate;benzoate |
| SMILES | O=C(ONC1CCCCC1)ONC1CCCCC1.O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C13H24N2O3.C7H6O2.Na/c16-13(17-14-11-7-3-1-4-8-11)18-15-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6;/h11-12,14-15H,1-10H2;1-5H,(H,8,9);/q;;+1/p-1 |
| InChIKey | SNIQQPUMMAWIGH-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;bis(cyclohexylamino) carbonate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;bis(cyclohexylamino) carbonate;benzoate?
The IUPAC name of sodium;bis(cyclohexylamino) carbonate;benzoate (CID 175308886) is sodium;bis(cyclohexylamino) carbonate;benzoate.
What is the SMILES notation for sodium;bis(cyclohexylamino) carbonate;benzoate?
The canonical SMILES for sodium;bis(cyclohexylamino) carbonate;benzoate is O=C(ONC1CCCCC1)ONC1CCCCC1.O=C([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;bis(cyclohexylamino) carbonate;benzoate?
The InChIKey is SNIQQPUMMAWIGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H24N2O3.C7H6O2.Na/c16-13(17-14-11-7-3-1-4-8-11)18-15-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6;/h11-12,14-15H,1-10H2;1-5H,(H,8,9);/q;;+1/p-1.
What are the key properties of sodium;bis(cyclohexylamino) carbonate;benzoate?
sodium;bis(cyclohexylamino) carbonate;benzoate has a molecular weight of 400.45 g/mol, XLogP of -0.13, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;bis(cyclohexylamino) carbonate;benzoate is sourced from PubChem (CID 175308886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).