C14H28N4O3 — CID 118033759
tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-hydrazinylcyclohexyl]carbamate (PubChem CID 118033759) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-hydrazinylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-hydrazinylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 118033759 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | tert-butyl N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-hydrazinylcyclohexyl]carbamate |
| SMILES | CN(C)C(=O)[C@H]1CC[C@H](NN)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N4O3/c1-14(2,3)21-13(20)16-11-8-9(12(19)18(4)5)6-7-10(11)17-15/h9-11,17H,6-8,15H2,1-5H3,(H,16,20)/t9-,10-,11+/m0/s1 |
| InChIKey | NMRJUGOMMUHNNB-GARJFASQSA-N |
| XLogP | 0.60 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|