C13H16Cl2N2O2 — CID 91247310
tert-butyl N-[2-(3,5-dichloro-2-pyridinyl)cyclopropyl]carbamate (PubChem CID 91247310) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is tert-butyl N-[2-(3,5-dichloro-2-pyridinyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,5-dichloro-2-pyridinyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 91247310 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | tert-butyl N-[2-(3,5-dichloro-2-pyridinyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-13(2,3)19-12(18)17-10-5-8(10)11-9(15)4-7(14)6-16-11/h4,6,8,10H,5H2,1-3H3,(H,17,18) |
| InChIKey | UYSXQIVDYAXYSY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |