C23H30O3Si — CID 12574465
8-[tert-butyl(dimethyl)silyl]oxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione (PubChem CID 12574465) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione |
|---|---|
| PubChem CID | 12574465 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1C2C(=O)C3C4C=CC5C6C(=O)C1C1C2C3C(C45)C61 |
| InChI | InChI=1S/C23H30O3Si/c1-23(2,3)27(4,5)26-22-18-16-14-11(20(18)24)8-6-7-9-10(8)13(14)15-12(9)21(25)19(22)17(15)16/h6-19,22H,1-5H3 |
| InChIKey | FWRYDKHNELALTG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|