C15H24O6Si — CID 125034296
CID 125034296 (PubChem CID 125034296) has the molecular formula C15H24O6Si and a molecular weight of 328.44 g/mol.
| Compound Name | CID 125034296 |
|---|---|
| PubChem CID | 125034296 |
| Molecular Formula | C15H24O6Si |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)OC1[C@H]2OC3OC([C@@]24CO4)[C@@]2(CO2)[C@@H]1O3 |
| InChI | InChI=1S/C15H24O6Si/c1-13(2,3)22(4,5)21-8-9-14(6-16-14)11-15(7-17-15)10(8)19-12(18-9)20-11/h8-12H,6-7H2,1-5H3/t8?,9-,10-,11?,12?,14-,15-/m1/s1 |
| InChIKey | IKSPCKYLNCKQEI-BDRQRMBJSA-N |
| XLogP | 1.39 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|