C11H24O4Si — CID 20612986
4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2,3-diol (PubChem CID 20612986) has the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2,3-diol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2,3-diol |
|---|---|
| PubChem CID | 20612986 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-5-methyloxolane-2,3-diol |
| SMILES | CC1OC(O)C(O)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H24O4Si/c1-7-9(8(12)10(13)14-7)15-16(5,6)11(2,3)4/h7-10,12-13H,1-6H3 |
| InChIKey | SWIDLDYVGWZSDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|