C20H36O3Si — CID 11046408
(1S,2S,3R,4S,5R,6R)-10-[tert-butyl(dimethyl)silyl]oxy-11-propan-2-ylidenetricyclo[4.3.1.12,5]undecane-3,4-diol (PubChem CID 11046408) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R,6R)-10-[tert-butyl(dimethyl)silyl]oxy-11-propan-2-ylidenetricyclo[4.3.1.12,5]undecane-3,4-diol.
| Compound Name | (1S,2S,3R,4S,5R,6R)-10-[tert-butyl(dimethyl)silyl]oxy-11-propan-2-ylidenetricyclo[4.3.1.12,5]undecane-3,4-diol |
|---|---|
| PubChem CID | 11046408 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (1S,2S,3R,4S,5R,6R)-10-[tert-butyl(dimethyl)silyl]oxy-11-propan-2-ylidenetricyclo[4.3.1.12,5]undecane-3,4-diol |
| SMILES | CC(C)=C1[C@@H]2[C@H](O)[C@H](O)[C@H]1[C@@H]1CCC[C@H]2C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-11(2)14-15-12-9-8-10-13(16(14)18(22)17(15)21)19(12)23-24(6,7)20(3,4)5/h12-13,15-19,21-22H,8-10H2,1-7H3/t12-,13+,15-,16+,17+,18-,19? |
| InChIKey | IOJUHWPOMKFLDR-SNLKRWAESA-N |
| XLogP | 4.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|