C26H56O7Si3 — CID 23245210
(3S,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(dimethoxymethyl)oxan-2-one (PubChem CID 23245210) has the molecular formula C26H56O7Si3 and a molecular weight of 564.99 g/mol. Its IUPAC name is (3S,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(dimethoxymethyl)oxan-2-one.
| Compound Name | (3S,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(dimethoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 23245210 |
| Molecular Formula | C26H56O7Si3 |
| Molecular Weight | 564.99 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | (3S,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(dimethoxymethyl)oxan-2-one |
| SMILES | COC(OC)[C@@H]1OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O7Si3/c1-24(2,3)34(12,13)31-18-19(32-35(14,15)25(4,5)6)21(23(28-10)29-11)30-22(27)20(18)33-36(16,17)26(7,8)9/h18-21,23H,1-17H3/t18-,19-,20-,21+/m0/s1 |
| InChIKey | XVKHGAMMAIEBIO-XSDIEEQYSA-N |
| XLogP | 6.70 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.99 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|