C10H14O5 — CID 22214434
(1R,2R,4R,6R,7S)-7-(dimethoxymethyl)-3,8-dioxatricyclo[4.3.0.02,4]nonan-9-one (PubChem CID 22214434) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1R,2R,4R,6R,7S)-7-(dimethoxymethyl)-3,8-dioxatricyclo[4.3.0.02,4]nonan-9-one.
| Compound Name | (1R,2R,4R,6R,7S)-7-(dimethoxymethyl)-3,8-dioxatricyclo[4.3.0.02,4]nonan-9-one |
|---|---|
| PubChem CID | 22214434 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1R,2R,4R,6R,7S)-7-(dimethoxymethyl)-3,8-dioxatricyclo[4.3.0.02,4]nonan-9-one |
| SMILES | COC(OC)[C@H]1OC(=O)[C@@H]2[C@H]1C[C@H]1O[C@H]21 |
| InChI | InChI=1S/C10H14O5/c1-12-10(13-2)7-4-3-5-8(14-5)6(4)9(11)15-7/h4-8,10H,3H2,1-2H3/t4-,5-,6-,7+,8+/m1/s1 |
| InChIKey | QCMPBVLSGSUMNW-YQXRAVKXSA-N |
| XLogP | -0.07 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|