C13H11BrO4 — CID 139903769
methyl 12-bromo-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene-10-carboxylate (PubChem CID 139903769) has the molecular formula C13H11BrO4 and a molecular weight of 311.13 g/mol. Its IUPAC name is methyl 12-bromo-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene-10-carboxylate.
| Compound Name | methyl 12-bromo-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene-10-carboxylate |
|---|---|
| PubChem CID | 139903769 |
| Molecular Formula | C13H11BrO4 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | methyl 12-bromo-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene-10-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2c1OC1CC3OC3C21 |
| InChI | InChI=1S/C13H11BrO4/c1-16-13(15)7-3-5(14)2-6-10-8(17-11(6)7)4-9-12(10)18-9/h2-3,8-10,12H,4H2,1H3 |
| InChIKey | VVSGUMLHVRBSDS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|