C19H30O4SSi — CID 11646651
(2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-methyl-2-phenylsulfanylcyclohexan-1-one (PubChem CID 11646651) has the molecular formula C19H30O4SSi and a molecular weight of 382.60 g/mol. Its IUPAC name is (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-methyl-2-phenylsulfanylcyclohexan-1-one.
| Compound Name | (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-methyl-2-phenylsulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 11646651 |
| Molecular Formula | C19H30O4SSi |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2-methyl-2-phenylsulfanylcyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@](C)(Sc2ccccc2)C(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30O4SSi/c1-18(2,3)25(5,6)23-14-12-19(4,17(22)16(21)15(14)20)24-13-10-8-7-9-11-13/h7-11,14-16,20-21H,12H2,1-6H3/t14-,15+,16+,19-/m1/s1 |
| InChIKey | ZWJFPFMUBUKRFB-PASDCYSWSA-N |
| XLogP | 3.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|