C19H42O5Si2 — CID 11761328
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(hydroxymethyl)cyclohexane-1,4-diol (PubChem CID 11761328) has the molecular formula C19H42O5Si2 and a molecular weight of 406.71 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(hydroxymethyl)cyclohexane-1,4-diol.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(hydroxymethyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 11761328 |
| Molecular Formula | C19H42O5Si2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(hydroxymethyl)cyclohexane-1,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(O)(CO)C[C@@H](O[Si](C)(C)C(C)(C)C)C1O |
| InChI | InChI=1S/C19H42O5Si2/c1-17(2,3)25(7,8)23-14-11-19(22,13-20)12-15(16(14)21)24-26(9,10)18(4,5)6/h14-16,20-22H,11-13H2,1-10H3/t14-,15-,16?,19?/m1/s1 |
| InChIKey | WTOWGPUIWHIKNF-JYMZVQIXSA-N |
| XLogP | 3.65 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|