C15H22O3 — CID 101495533
3-methyl-5,5-bis(prop-2-enoxymethyl)cyclohex-2-en-1-one (PubChem CID 101495533) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-methyl-5,5-bis(prop-2-enoxymethyl)cyclohex-2-en-1-one.
| Compound Name | 3-methyl-5,5-bis(prop-2-enoxymethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 101495533 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3-methyl-5,5-bis(prop-2-enoxymethyl)cyclohex-2-en-1-one |
| SMILES | C=CCOCC1(COCC=C)CC(=O)C=C(C)C1 |
| InChI | InChI=1S/C15H22O3/c1-4-6-17-11-15(12-18-7-5-2)9-13(3)8-14(16)10-15/h4-5,8H,1-2,6-7,9-12H2,3H3 |
| InChIKey | VCMLXTNXNPYVMG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|