C18H33NO4 — CID 10426602
methyl (2S,3R,6R)-2-[3-(methoxymethoxy)propyl]-3-methyl-6-pent-4-enylpiperidine-1-carboxylate (PubChem CID 10426602) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is methyl (2S,3R,6R)-2-[3-(methoxymethoxy)propyl]-3-methyl-6-pent-4-enylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,3R,6R)-2-[3-(methoxymethoxy)propyl]-3-methyl-6-pent-4-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10426602 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | methyl (2S,3R,6R)-2-[3-(methoxymethoxy)propyl]-3-methyl-6-pent-4-enylpiperidine-1-carboxylate |
| SMILES | C=CCCC[C@@H]1CC[C@@H](C)[C@H](CCCOCOC)N1C(=O)OC |
| InChI | InChI=1S/C18H33NO4/c1-5-6-7-9-16-12-11-15(2)17(19(16)18(20)22-4)10-8-13-23-14-21-3/h5,15-17H,1,6-14H2,2-4H3/t15-,16-,17+/m1/s1 |
| InChIKey | UUSFPZYJYOKKND-ZACQAIPSSA-N |
| XLogP | 3.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|