C12H23NO5 — CID 10422764
methyl (2S,6S)-2-(hydroxymethyl)-6-[2-(methoxymethoxy)ethyl]piperidine-1-carboxylate (PubChem CID 10422764) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl (2S,6S)-2-(hydroxymethyl)-6-[2-(methoxymethoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | methyl (2S,6S)-2-(hydroxymethyl)-6-[2-(methoxymethoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10422764 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | methyl (2S,6S)-2-(hydroxymethyl)-6-[2-(methoxymethoxy)ethyl]piperidine-1-carboxylate |
| SMILES | COCOCC[C@@H]1CCC[C@@H](CO)N1C(=O)OC |
| InChI | InChI=1S/C12H23NO5/c1-16-9-18-7-6-10-4-3-5-11(8-14)13(10)12(15)17-2/h10-11,14H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | JUVLSMCPYXXMCF-QWRGUYRKSA-N |
| XLogP | 0.98 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|