C15H27NO4 — CID 72544080
tert-butyl (2S,3S,6S)-6-ethenyl-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate (PubChem CID 72544080) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl (2S,3S,6S)-6-ethenyl-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,6S)-6-ethenyl-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 72544080 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | tert-butyl (2S,3S,6S)-6-ethenyl-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate |
| SMILES | C=C[C@@H]1CC[C@H](OCOC)[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-7-12-8-9-13(19-10-18-6)11(2)16(12)14(17)20-15(3,4)5/h7,11-13H,1,8-10H2,2-6H3/t11-,12+,13-/m0/s1 |
| InChIKey | RDKJZVILMKVQTA-XQQFMLRXSA-N |
| XLogP | 2.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|