C22H39NO4 — CID 10619857
methyl (2R,3R,6R)-6-[(2E)-dodeca-2,11-dienyl]-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate (PubChem CID 10619857) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is methyl (2R,3R,6R)-6-[(2E)-dodeca-2,11-dienyl]-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate.
| Compound Name | methyl (2R,3R,6R)-6-[(2E)-dodeca-2,11-dienyl]-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10619857 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | methyl (2R,3R,6R)-6-[(2E)-dodeca-2,11-dienyl]-3-(methoxymethoxy)-2-methylpiperidine-1-carboxylate |
| SMILES | C=CCCCCCCC/C=C/C[C@H]1CC[C@@H](OCOC)[C@@H](C)N1C(=O)OC |
| InChI | InChI=1S/C22H39NO4/c1-5-6-7-8-9-10-11-12-13-14-15-20-16-17-21(27-18-25-3)19(2)23(20)22(24)26-4/h5,13-14,19-21H,1,6-12,15-18H2,2-4H3/b14-13+/t19-,20+,21-/m1/s1 |
| InChIKey | OPSKAOOVPVDYHY-ZUCHDKECSA-N |
| XLogP | 5.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|