C14H25NO — CID 14784829
1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]oct-7-en-1-one (PubChem CID 14784829) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]oct-7-en-1-one.
| Compound Name | 1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]oct-7-en-1-one |
|---|---|
| PubChem CID | 14784829 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]oct-7-en-1-one |
| SMILES | C=CCCCCCC(=O)N1[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-14(16)15-12(2)10-11-13(15)3/h4,12-13H,1,5-11H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | PVPNDWYBYSWVDI-CHWSQXEVSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|