C15H26O3 — CID 167438008
methyl 2-undeca-1,10-dienoxypropanoate (PubChem CID 167438008) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is methyl 2-undeca-1,10-dienoxypropanoate.
| Compound Name | methyl 2-undeca-1,10-dienoxypropanoate |
|---|---|
| PubChem CID | 167438008 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | methyl 2-undeca-1,10-dienoxypropanoate |
| SMILES | C=CCCCCCCCC=COC(C)C(=O)OC |
| InChI | InChI=1S/C15H26O3/c1-4-5-6-7-8-9-10-11-12-13-18-14(2)15(16)17-3/h4,12-14H,1,5-11H2,2-3H3 |
| InChIKey | KYGXWLDDGGPXLM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|