C25H38O7 — CID 134916516
methyl (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethyl-3-oxospiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-2-carboxylate (PubChem CID 134916516) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is methyl (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethyl-3-oxospiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-2-carboxylate.
| Compound Name | methyl (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethyl-3-oxospiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-2-carboxylate |
|---|---|
| PubChem CID | 134916516 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl (4bR,8S)-10a-(2-ethoxyethoxymethyl)-4b,8-dimethyl-3-oxospiro[1,2,4,4a,5,6,8,10-octahydrophenanthrene-7,2'-1,3-dioxolane]-2-carboxylate |
| SMILES | CCOCCOCC12CC=C3[C@H](C)C4(CC[C@]3(C)C1CC(=O)C(C(=O)OC)C2)OCCO4 |
| InChI | InChI=1S/C25H38O7/c1-5-29-10-11-30-16-24-7-6-19-17(2)25(31-12-13-32-25)9-8-23(19,3)21(24)14-20(26)18(15-24)22(27)28-4/h6,17-18,21H,5,7-16H2,1-4H3/t17-,18?,21?,23-,24?/m0/s1 |
| InChIKey | JQDRYKNPWYGPBM-APVHVDEQSA-N |
| XLogP | 3.30 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|