C13H20O5 — CID 123581536
methyl 4-(2-ethoxyethoxy)-3-methoxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 123581536) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 4-(2-ethoxyethoxy)-3-methoxycyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 4-(2-ethoxyethoxy)-3-methoxycyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 123581536 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl 4-(2-ethoxyethoxy)-3-methoxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOCCOC1=CCC(C(=O)OC)C=C1OC |
| InChI | InChI=1S/C13H20O5/c1-4-17-7-8-18-11-6-5-10(13(14)16-3)9-12(11)15-2/h6,9-10H,4-5,7-8H2,1-3H3 |
| InChIKey | RCLPQBKAEPJYDF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|