C7H6O — CID 71445549
(1R)-bicyclo[3.2.0]hepta-3,6-dien-2-one (PubChem CID 71445549) has the molecular formula C7H6O and a molecular weight of 106.12 g/mol. Its IUPAC name is (1R)-bicyclo[3.2.0]hepta-3,6-dien-2-one.
| Compound Name | (1R)-bicyclo[3.2.0]hepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 71445549 |
| Molecular Formula | C7H6O |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.04 |
| IUPAC Name | (1R)-bicyclo[3.2.0]hepta-3,6-dien-2-one |
| SMILES | O=C1C=CC2C=C[C@@H]12 |
| InChI | InChI=1S/C7H6O/c8-7-4-2-5-1-3-6(5)7/h1-6H/t5?,6-/m1/s1 |
| InChIKey | MPLZNSSYMBHANZ-PRJDIBJQSA-N |
| XLogP | 0.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|