C10H8O4 — CID 12702300
5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-1-carboxylic acid (PubChem CID 12702300) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-1-carboxylic acid.
| Compound Name | 5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 12702300 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-1-carboxylic acid |
| SMILES | O=C1C=CC2C1C1C=CC2(C(=O)O)O1 |
| InChI | InChI=1S/C10H8O4/c11-6-2-1-5-8(6)7-3-4-10(5,14-7)9(12)13/h1-5,7-8H,(H,12,13) |
| InChIKey | NVJYXBMLLCVXOV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|