C10H10O5 — CID 100875365
methyl (1S,2R,6S,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-1-carboxylate (PubChem CID 100875365) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is methyl (1S,2R,6S,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-1-carboxylate.
| Compound Name | methyl (1S,2R,6S,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-1-carboxylate |
|---|---|
| PubChem CID | 100875365 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | methyl (1S,2R,6S,7R)-3-oxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12C=C[C@@H](O1)[C@@H]1COC(=O)[C@H]12 |
| InChI | InChI=1S/C10H10O5/c1-13-9(12)10-3-2-6(15-10)5-4-14-8(11)7(5)10/h2-3,5-7H,4H2,1H3/t5-,6+,7-,10-/m0/s1 |
| InChIKey | MLUUUQDIPOJVQP-XIVUIJJLSA-N |
| XLogP | -0.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|