C11H12O5 — CID 23259974
(1R,2R,6R,7S)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 23259974) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is (1R,2R,6R,7S)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2R,6R,7S)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 23259974 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (1R,2R,6R,7S)-1-(1,3-dioxolan-2-yl)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | O=C1OC[C@@H]2[C@@H]3C=C[C@@](C4OCCO4)(O3)[C@H]12 |
| InChI | InChI=1S/C11H12O5/c12-9-8-6(5-15-9)7-1-2-11(8,16-7)10-13-3-4-14-10/h1-2,6-8,10H,3-5H2/t6-,7+,8+,11-/m1/s1 |
| InChIKey | UTKUCUNROYCNMU-OFHVYEONSA-N |
| XLogP | -0.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|