C17H14BrNO5 — CID 126286226
(3aR,4R,7R,7aS)-2-(2-bromophenyl)-7-(1,3-dioxolan-2-yl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 126286226) has the molecular formula C17H14BrNO5 and a molecular weight of 392.21 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-2-(2-bromophenyl)-7-(1,3-dioxolan-2-yl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-2-(2-bromophenyl)-7-(1,3-dioxolan-2-yl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 126286226 |
| Molecular Formula | C17H14BrNO5 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (3aR,4R,7R,7aS)-2-(2-bromophenyl)-7-(1,3-dioxolan-2-yl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@H]2[C@H]3C=C[C@@](C4OCCO4)(O3)[C@H]2C(=O)N1c1ccccc1Br |
| InChI | InChI=1S/C17H14BrNO5/c18-9-3-1-2-4-10(9)19-14(20)12-11-5-6-17(24-11,13(12)15(19)21)16-22-7-8-23-16/h1-6,11-13,16H,7-8H2/t11-,12+,13-,17-/m1/s1 |
| InChIKey | ILMZPCGHDGSCAX-IPJQOSJUSA-N |
| XLogP | 1.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|