C13H14O3 — CID 102263079
6-hydroxy-6-methyl-2-(4-methylphenyl)pyran-3-one (PubChem CID 102263079) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 6-hydroxy-6-methyl-2-(4-methylphenyl)pyran-3-one.
| Compound Name | 6-hydroxy-6-methyl-2-(4-methylphenyl)pyran-3-one |
|---|---|
| PubChem CID | 102263079 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 6-hydroxy-6-methyl-2-(4-methylphenyl)pyran-3-one |
| SMILES | Cc1ccc(C2OC(C)(O)C=CC2=O)cc1 |
| InChI | InChI=1S/C13H14O3/c1-9-3-5-10(6-4-9)12-11(14)7-8-13(2,15)16-12/h3-8,12,15H,1-2H3 |
| InChIKey | ANPFVTWRYJILSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |