C13H16O2 — CID 155934344
(5S)-3,3-dimethyl-5-(4-methylphenyl)oxolan-2-one (PubChem CID 155934344) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (5S)-3,3-dimethyl-5-(4-methylphenyl)oxolan-2-one.
| Compound Name | (5S)-3,3-dimethyl-5-(4-methylphenyl)oxolan-2-one |
|---|---|
| PubChem CID | 155934344 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (5S)-3,3-dimethyl-5-(4-methylphenyl)oxolan-2-one |
| SMILES | Cc1ccc([C@@H]2CC(C)(C)C(=O)O2)cc1 |
| InChI | InChI=1S/C13H16O2/c1-9-4-6-10(7-5-9)11-8-13(2,3)12(14)15-11/h4-7,11H,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | JMJWOFPZDGAKEF-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |