C10H12N2O2 — CID 105445915
6-(4-methylphenyl)-1,3,4-oxadiazinan-2-one (PubChem CID 105445915) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-(4-methylphenyl)-1,3,4-oxadiazinan-2-one.
| Compound Name | 6-(4-methylphenyl)-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 105445915 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-(4-methylphenyl)-1,3,4-oxadiazinan-2-one |
| SMILES | Cc1ccc(C2CNNC(=O)O2)cc1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-2-4-8(5-3-7)9-6-11-12-10(13)14-9/h2-5,9,11H,6H2,1H3,(H,12,13) |
| InChIKey | UAJWYRSTPPHKBK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |