C13H14O2 — CID 86228803
5-methyl-2-(4-methylphenyl)-2,3-dihydropyran-4-one (PubChem CID 86228803) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-methyl-2-(4-methylphenyl)-2,3-dihydropyran-4-one.
| Compound Name | 5-methyl-2-(4-methylphenyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 86228803 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-methyl-2-(4-methylphenyl)-2,3-dihydropyran-4-one |
| SMILES | CC1=COC(c2ccc(C)cc2)CC1=O |
| InChI | InChI=1S/C13H14O2/c1-9-3-5-11(6-4-9)13-7-12(14)10(2)8-15-13/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | XHMVWSQQQABOHV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |