C13H16O2 — CID 171853852
3,3-dimethyl-6-phenyloxan-2-one (PubChem CID 171853852) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,3-dimethyl-6-phenyloxan-2-one.
| Compound Name | 3,3-dimethyl-6-phenyloxan-2-one |
|---|---|
| PubChem CID | 171853852 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3,3-dimethyl-6-phenyloxan-2-one |
| SMILES | CC1(C)CCC(c2ccccc2)OC1=O |
| InChI | InChI=1S/C13H16O2/c1-13(2)9-8-11(15-12(13)14)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | WLZYVQFIMMRJHP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |