C19H16O4 — CID 139042269
(6R,7S)-6,7-diphenyl-5,8-dioxaspiro[2.6]nonane-4,9-dione (PubChem CID 139042269) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is (6R,7S)-6,7-diphenyl-5,8-dioxaspiro[2.6]nonane-4,9-dione.
| Compound Name | (6R,7S)-6,7-diphenyl-5,8-dioxaspiro[2.6]nonane-4,9-dione |
|---|---|
| PubChem CID | 139042269 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (6R,7S)-6,7-diphenyl-5,8-dioxaspiro[2.6]nonane-4,9-dione |
| SMILES | O=C1O[C@H](c2ccccc2)[C@H](c2ccccc2)OC(=O)C12CC2 |
| InChI | InChI=1S/C19H16O4/c20-17-19(11-12-19)18(21)23-16(14-9-5-2-6-10-14)15(22-17)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+ |
| InChIKey | PYQRZULZHXGKHP-IYBDPMFKSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|