C21H26O3 — CID 880512
(16R)-16-phenyl-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione (PubChem CID 880512) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (16R)-16-phenyl-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione.
| Compound Name | (16R)-16-phenyl-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione |
|---|---|
| PubChem CID | 880512 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (16R)-16-phenyl-15-oxadispiro[5.1.58.36]hexadecane-7,14-dione |
| SMILES | O=C1O[C@H](c2ccccc2)C2(CCCCC2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C21H26O3/c22-18-20(12-6-2-7-13-20)17(16-10-4-1-5-11-16)24-19(23)21(18)14-8-3-9-15-21/h1,4-5,10-11,17H,2-3,6-9,12-15H2/t17-/m1/s1 |
| InChIKey | NYAMEJNMRAEZKM-QGZVFWFLSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|