About (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione
(8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione (PubChem CID 974943) has the molecular formula C15H18O4
and a molecular weight of 262.30 g/mol. Its IUPAC name is (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione.
Molecular Properties
| Compound Name | (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione |
| PubChem CID | 974943 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione |
| SMILES | CC1(C)C(=O)C2(CCCC2)C(=O)O[C@H]1c1ccco1 |
| InChI | InChI=1S/C15H18O4/c1-14(2)11(10-6-5-9-18-10)19-13(17)15(12(14)16)7-3-4-8-15/h5-6,9,11H,3-4,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | TYENMNXJLRIOAZ-NSHDSACASA-N |
| XLogP | 3.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione?
The IUPAC name of (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione (CID 974943) is (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione.
What is the SMILES notation for (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione?
The canonical SMILES for (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione is CC1(C)C(=O)C2(CCCC2)C(=O)O[C@H]1c1ccco1.
What is the InChIKey of (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione?
The InChIKey is TYENMNXJLRIOAZ-NSHDSACASA-N. The full InChI is InChI=1S/C15H18O4/c1-14(2)11(10-6-5-9-18-10)19-13(17)15(12(14)16)7-3-4-8-15/h5-6,9,11H,3-4,7-8H2,1-2H3/t11-/m0/s1.
What are the key properties of (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione?
(8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione has a molecular weight of 262.30 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-8-(furan-2-yl)-9,9-dimethyl-7-oxaspiro[4.5]decane-6,10-dione is sourced from PubChem (CID 974943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).