C20H22O5 — CID 162908443
(1R,4R,5'R,9S,10R)-5'-(furan-2-yl)-4,10-dimethylspiro[2-oxatricyclo[6.3.1.04,12]dodec-8(12)-ene-9,3'-oxolane]-2',3-dione (PubChem CID 162908443) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (1R,4R,5'R,9S,10R)-5'-(furan-2-yl)-4,10-dimethylspiro[2-oxatricyclo[6.3.1.04,12]dodec-8(12)-ene-9,3'-oxolane]-2',3-dione.
| Compound Name | (1R,4R,5'R,9S,10R)-5'-(furan-2-yl)-4,10-dimethylspiro[2-oxatricyclo[6.3.1.04,12]dodec-8(12)-ene-9,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 162908443 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1R,4R,5'R,9S,10R)-5'-(furan-2-yl)-4,10-dimethylspiro[2-oxatricyclo[6.3.1.04,12]dodec-8(12)-ene-9,3'-oxolane]-2',3-dione |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@]3(C)CCCC(=C23)[C@]12C[C@H](c1ccco1)OC2=O |
| InChI | InChI=1S/C20H22O5/c1-11-9-14-16-12(5-3-7-19(16,2)17(21)24-14)20(11)10-15(25-18(20)22)13-6-4-8-23-13/h4,6,8,11,14-15H,3,5,7,9-10H2,1-2H3/t11-,14-,15-,19-,20+/m1/s1 |
| InChIKey | IQEKRSIWCDUGJG-IZHDIEGXSA-N |
| XLogP | 3.71 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|