C19H20O5 — CID 162966136
(1S,5'S,8R,9R,10R)-5'-(furan-2-yl)-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione (PubChem CID 162966136) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (1S,5'S,8R,9R,10R)-5'-(furan-2-yl)-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione.
| Compound Name | (1S,5'S,8R,9R,10R)-5'-(furan-2-yl)-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 162966136 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (1S,5'S,8R,9R,10R)-5'-(furan-2-yl)-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione |
| SMILES | C[C@@H]1C[C@@H]2OC(=O)C3=C2[C@@H](CCC3)[C@@]12C[C@@H](c1ccco1)OC2=O |
| InChI | InChI=1S/C19H20O5/c1-10-8-14-16-11(17(20)23-14)4-2-5-12(16)19(10)9-15(24-18(19)21)13-6-3-7-22-13/h3,6-7,10,12,14-15H,2,4-5,8-9H2,1H3/t10-,12-,14+,15+,19-/m1/s1 |
| InChIKey | GTSQALPWCMBFEI-DDYIAVBWSA-N |
| XLogP | 3.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |