C19H20O7 — CID 163195110
(1R,5'S,8S,9R,10R)-5'-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione (PubChem CID 163195110) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is (1R,5'S,8S,9R,10R)-5'-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione.
| Compound Name | (1R,5'S,8S,9R,10R)-5'-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 163195110 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (1R,5'S,8S,9R,10R)-5'-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodec-4(12)-ene-9,3'-oxolane]-2',3-dione |
| SMILES | C[C@@H]1C[C@H]2OC(=O)C3=C2[C@H](CCC3)[C@@]12C[C@@H](C1=C[C@H](O)OC1=O)OC2=O |
| InChI | InChI=1S/C19H20O7/c1-8-5-12-15-9(16(21)24-12)3-2-4-11(15)19(8)7-13(25-18(19)23)10-6-14(20)26-17(10)22/h6,8,11-14,20H,2-5,7H2,1H3/t8-,11+,12-,13+,14-,19-/m1/s1 |
| InChIKey | KSHGBTGXIQFWKH-LMPHNHLCSA-N |
| XLogP | 1.15 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|