C23H28O10 — CID 162940407
methyl 9-acetyloxy-2-(2-hydroxy-5-oxo-2H-furan-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 162940407) has the molecular formula C23H28O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is methyl 9-acetyloxy-2-(2-hydroxy-5-oxo-2H-furan-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl 9-acetyloxy-2-(2-hydroxy-5-oxo-2H-furan-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 162940407 |
| Molecular Formula | C23H28O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | methyl 9-acetyloxy-2-(2-hydroxy-5-oxo-2H-furan-4-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)C1CC(OC(C)=O)C(=O)C2C1(C)CCC1C(=O)OC(C3=CC(O)OC3=O)CC12C |
| InChI | InChI=1S/C23H28O10/c1-10(24)31-14-8-13(20(28)30-4)22(2)6-5-12-21(29)32-15(11-7-16(25)33-19(11)27)9-23(12,3)18(22)17(14)26/h7,12-16,18,25H,5-6,8-9H2,1-4H3 |
| InChIKey | WUYGOOXHDSWMJT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|