C10H14O2 — CID 25138454
(2S,6S)-2-(furan-2-yl)-6-methyloxane (PubChem CID 25138454) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2S,6S)-2-(furan-2-yl)-6-methyloxane.
| Compound Name | (2S,6S)-2-(furan-2-yl)-6-methyloxane |
|---|---|
| PubChem CID | 25138454 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2S,6S)-2-(furan-2-yl)-6-methyloxane |
| SMILES | C[C@H]1CCC[C@@H](c2ccco2)O1 |
| InChI | InChI=1S/C10H14O2/c1-8-4-2-5-10(12-8)9-6-3-7-11-9/h3,6-8,10H,2,4-5H2,1H3/t8-,10-/m0/s1 |
| InChIKey | ZFXUCSVUPLVELI-WPRPVWTQSA-N |
| XLogP | 2.91 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |