C10H14O2 — CID 95256771
cis-(1R,2S)-2-(furan-2-yl)cyclohexan-1-ol (PubChem CID 95256771) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is cis-(1R,2S)-2-(furan-2-yl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(furan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 95256771 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | cis-(1R,2S)-2-(furan-2-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C10H14O2/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h3,6-9,11H,1-2,4-5H2/t8-,9+/m0/s1 |
| InChIKey | ZPJHTKRSIFBJMU-DTWKUNHWSA-N |
| XLogP | 2.30 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |