C7H9NO2 — CID 166135335
(3R)-3-(furan-2-yl)-1,2-oxazolidine (PubChem CID 166135335) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (3R)-3-(furan-2-yl)-1,2-oxazolidine.
| Compound Name | (3R)-3-(furan-2-yl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 166135335 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (3R)-3-(furan-2-yl)-1,2-oxazolidine |
| SMILES | c1coc([C@H]2CCON2)c1 |
| InChI | InChI=1S/C7H9NO2/c1-2-7(9-4-1)6-3-5-10-8-6/h1-2,4,6,8H,3,5H2/t6-/m1/s1 |
| InChIKey | LQDBCZBLTMKZRX-ZCFIWIBFSA-N |
| XLogP | 1.25 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |