About 2-(thian-4-yl)furan
2-(thian-4-yl)furan (PubChem CID 68570880) has the molecular formula C9H12OS
and a molecular weight of 168.26 g/mol. Its IUPAC name is 2-(thian-4-yl)furan.
Molecular Properties
| Compound Name | 2-(thian-4-yl)furan |
| PubChem CID | 68570880 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 2-(thian-4-yl)furan |
| SMILES | c1coc(C2CCSCC2)c1 |
| InChI | InChI=1S/C9H12OS/c1-2-9(10-5-1)8-3-6-11-7-4-8/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | CJIGQAXPBDUSHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(thian-4-yl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thian-4-yl)furan?
The IUPAC name of 2-(thian-4-yl)furan (CID 68570880) is 2-(thian-4-yl)furan.
What is the SMILES notation for 2-(thian-4-yl)furan?
The canonical SMILES for 2-(thian-4-yl)furan is c1coc(C2CCSCC2)c1.
What is the InChIKey of 2-(thian-4-yl)furan?
The InChIKey is CJIGQAXPBDUSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12OS/c1-2-9(10-5-1)8-3-6-11-7-4-8/h1-2,5,8H,3-4,6-7H2.
What are the key properties of 2-(thian-4-yl)furan?
2-(thian-4-yl)furan has a molecular weight of 168.26 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thian-4-yl)furan is sourced from PubChem (CID 68570880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).