C11H13NO2S — CID 5323919
7-(furan-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one (PubChem CID 5323919) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 7-(furan-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one.
| Compound Name | 7-(furan-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 5323919 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 7-(furan-2-yl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
| SMILES | O=C1CC(c2ccco2)CC2SCCN12 |
| InChI | InChI=1S/C11H13NO2S/c13-10-6-8(9-2-1-4-14-9)7-11-12(10)3-5-15-11/h1-2,4,8,11H,3,5-7H2 |
| InChIKey | DNCLYHFGTLJWOU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |