C7H6O3S — CID 139228180
2-(furan-2-yl)-1,3-oxathiolan-5-one (PubChem CID 139228180) has the molecular formula C7H6O3S and a molecular weight of 170.19 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,3-oxathiolan-5-one.
| Compound Name | 2-(furan-2-yl)-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139228180 |
| Molecular Formula | C7H6O3S |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 2-(furan-2-yl)-1,3-oxathiolan-5-one |
| SMILES | O=C1CSC(c2ccco2)O1 |
| InChI | InChI=1S/C7H6O3S/c8-6-4-11-7(10-6)5-2-1-3-9-5/h1-3,7H,4H2 |
| InChIKey | UVVKLKKPGNPUIV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |